C31H36F2O6S2 — CID 87614179
2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonate;5-[2-(4-phenylphenyl)ethyl]-6-oxa-1-thioniabicyclo[3.1.0]hexane (PubChem CID 87614179) has the molecular formula C31H36F2O6S2 and a molecular weight of 606.75 g/mol. Its IUPAC name is 2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonate;5-[2-(4-phenylphenyl)ethyl]-6-oxa-1-thioniabicyclo[3.1.0]hexane.
| Compound Name | 2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonate;5-[2-(4-phenylphenyl)ethyl]-6-oxa-1-thioniabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 87614179 |
| Molecular Formula | C31H36F2O6S2 |
| Molecular Weight | 606.75 g/mol |
| Exact Mass | 606.19 |
| IUPAC Name | 2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonate;5-[2-(4-phenylphenyl)ethyl]-6-oxa-1-thioniabicyclo[3.1.0]hexane |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)C(F)(F)S(=O)(=O)[O-].c1ccc(-c2ccc(CCC34CCC[S+]3O4)cc2)cc1 |
| InChI | InChI=1S/C18H19OS.C13H18F2O5S/c1-2-5-16(6-3-1)17-9-7-15(8-10-17)11-13-18-12-4-14-20(18)19-18;14-13(15,21(17,18)19)11(16)20-7-12-4-8-1-9(5-12)3-10(2-8)6-12/h1-3,5-10H,4,11-14H2;8-10H,1-7H2,(H,17,18,19)/q+1;/p-1 |
| InChIKey | YMFRFMWSKVRLBX-UHFFFAOYSA-M |
| XLogP | 6.22 |
| TPSA | 96.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.75 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|