About [1-(4,5-diphenyl-1H-imidazol-2-yl)-5-(ethylsulfanylamino)pentyl]carbamic acid
[1-(4,5-diphenyl-1H-imidazol-2-yl)-5-(ethylsulfanylamino)pentyl]carbamic acid (PubChem CID 87614221) has the molecular formula C23H28N4O2S
and a molecular weight of 424.57 g/mol. Its IUPAC name is [1-(4,5-diphenyl-1H-imidazol-2-yl)-5-(ethylsulfanylamino)pentyl]carbamic acid.
Molecular Properties
| Compound Name | [1-(4,5-diphenyl-1H-imidazol-2-yl)-5-(ethylsulfanylamino)pentyl]carbamic acid |
| PubChem CID | 87614221 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | [1-(4,5-diphenyl-1H-imidazol-2-yl)-5-(ethylsulfanylamino)pentyl]carbamic acid |
| SMILES | CCSNCCCCC(NC(=O)O)c1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C23H28N4O2S/c1-2-30-24-16-10-9-15-19(25-23(28)29)22-26-20(17-11-5-3-6-12-17)21(27-22)18-13-7-4-8-14-18/h3-8,11-14,19,24-25H,2,9-10,15-16H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | QVBRKYXAWNFEFT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(4,5-diphenyl-1H-imidazol-2-yl)-5-(ethylsulfanylamino)pentyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4,5-diphenyl-1H-imidazol-2-yl)-5-(ethylsulfanylamino)pentyl]carbamic acid?
The IUPAC name of [1-(4,5-diphenyl-1H-imidazol-2-yl)-5-(ethylsulfanylamino)pentyl]carbamic acid (CID 87614221) is [1-(4,5-diphenyl-1H-imidazol-2-yl)-5-(ethylsulfanylamino)pentyl]carbamic acid.
What is the SMILES notation for [1-(4,5-diphenyl-1H-imidazol-2-yl)-5-(ethylsulfanylamino)pentyl]carbamic acid?
The canonical SMILES for [1-(4,5-diphenyl-1H-imidazol-2-yl)-5-(ethylsulfanylamino)pentyl]carbamic acid is CCSNCCCCC(NC(=O)O)c1nc(-c2ccccc2)c(-c2ccccc2)[nH]1.
What is the InChIKey of [1-(4,5-diphenyl-1H-imidazol-2-yl)-5-(ethylsulfanylamino)pentyl]carbamic acid?
The InChIKey is QVBRKYXAWNFEFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N4O2S/c1-2-30-24-16-10-9-15-19(25-23(28)29)22-26-20(17-11-5-3-6-12-17)21(27-22)18-13-7-4-8-14-18/h3-8,11-14,19,24-25H,2,9-10,15-16H2,1H3,(H,26,27)(H,28,29).
What are the key properties of [1-(4,5-diphenyl-1H-imidazol-2-yl)-5-(ethylsulfanylamino)pentyl]carbamic acid?
[1-(4,5-diphenyl-1H-imidazol-2-yl)-5-(ethylsulfanylamino)pentyl]carbamic acid has a molecular weight of 424.57 g/mol, XLogP of 5.48, 11 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4,5-diphenyl-1H-imidazol-2-yl)-5-(ethylsulfanylamino)pentyl]carbamic acid is sourced from PubChem (CID 87614221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).