C22H24ClN7O5 — CID 87614248
3-[(1S,2R,3S,4R)-4-[2-chloro-6-[hydroxymethyl(2-phenylethyl)amino]purin-9-yl]-2,3-dihydroxycyclopentyl]imidazolidine-2,4-dione (PubChem CID 87614248) has the molecular formula C22H24ClN7O5 and a molecular weight of 501.93 g/mol. Its IUPAC name is 3-[(1S,2R,3S,4R)-4-[2-chloro-6-[hydroxymethyl(2-phenylethyl)amino]purin-9-yl]-2,3-dihydroxycyclopentyl]imidazolidine-2,4-dione.
| Compound Name | 3-[(1S,2R,3S,4R)-4-[2-chloro-6-[hydroxymethyl(2-phenylethyl)amino]purin-9-yl]-2,3-dihydroxycyclopentyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 87614248 |
| Molecular Formula | C22H24ClN7O5 |
| Molecular Weight | 501.93 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 3-[(1S,2R,3S,4R)-4-[2-chloro-6-[hydroxymethyl(2-phenylethyl)amino]purin-9-yl]-2,3-dihydroxycyclopentyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1[C@H]1C[C@@H](n2cnc3c(N(CO)CCc4ccccc4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H24ClN7O5/c23-21-26-19(28(11-31)7-6-12-4-2-1-3-5-12)16-20(27-21)29(10-25-16)13-8-14(18(34)17(13)33)30-15(32)9-24-22(30)35/h1-5,10,13-14,17-18,31,33-34H,6-9,11H2,(H,24,35)/t13-,14+,17+,18-/m1/s1 |
| InChIKey | HQFCDVNHPLIVQI-IDCJVQTKSA-N |
| XLogP | 0.07 |
| TPSA | 156.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.93 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|