C15H20N6O3S — CID 87614448
[5-[carbamoyl(sulfanyl)amino]-1-(3-phenyl-1H-1,2,4-triazol-5-yl)pentyl]carbamic acid (PubChem CID 87614448) has the molecular formula C15H20N6O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is [5-[carbamoyl(sulfanyl)amino]-1-(3-phenyl-1H-1,2,4-triazol-5-yl)pentyl]carbamic acid.
| Compound Name | [5-[carbamoyl(sulfanyl)amino]-1-(3-phenyl-1H-1,2,4-triazol-5-yl)pentyl]carbamic acid |
|---|---|
| PubChem CID | 87614448 |
| Molecular Formula | C15H20N6O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | [5-[carbamoyl(sulfanyl)amino]-1-(3-phenyl-1H-1,2,4-triazol-5-yl)pentyl]carbamic acid |
| SMILES | NC(=O)N(S)CCCCC(NC(=O)O)c1nc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C15H20N6O3S/c16-14(22)21(25)9-5-4-8-11(17-15(23)24)13-18-12(19-20-13)10-6-2-1-3-7-10/h1-3,6-7,11,17,25H,4-5,8-9H2,(H2,16,22)(H,23,24)(H,18,19,20) |
| InChIKey | WFAPPNQUXYXFNC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|