About 5-chloro-2-methylsulfanyl-1,3-benzothiazole;3,4-dimethylbenzenesulfonic acid
5-chloro-2-methylsulfanyl-1,3-benzothiazole;3,4-dimethylbenzenesulfonic acid (PubChem CID 87614576) has the molecular formula C16H16ClNO3S3
and a molecular weight of 401.96 g/mol. Its IUPAC name is 5-chloro-2-methylsulfanyl-1,3-benzothiazole;3,4-dimethylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 5-chloro-2-methylsulfanyl-1,3-benzothiazole;3,4-dimethylbenzenesulfonic acid |
| PubChem CID | 87614576 |
| Molecular Formula | C16H16ClNO3S3 |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | 5-chloro-2-methylsulfanyl-1,3-benzothiazole;3,4-dimethylbenzenesulfonic acid |
| SMILES | CSc1nc2cc(Cl)ccc2s1.Cc1ccc(S(=O)(=O)O)cc1C |
| InChI | InChI=1S/C8H6ClNS2.C8H10O3S/c1-11-8-10-6-4-5(9)2-3-7(6)12-8;1-6-3-4-8(5-7(6)2)12(9,10)11/h2-4H,1H3;3-5H,1-2H3,(H,9,10,11) |
| InChIKey | VBIXDMYZOZMVQQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-methylsulfanyl-1,3-benzothiazole;3,4-dimethylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-methylsulfanyl-1,3-benzothiazole;3,4-dimethylbenzenesulfonic acid?
The IUPAC name of 5-chloro-2-methylsulfanyl-1,3-benzothiazole;3,4-dimethylbenzenesulfonic acid (CID 87614576) is 5-chloro-2-methylsulfanyl-1,3-benzothiazole;3,4-dimethylbenzenesulfonic acid.
What is the SMILES notation for 5-chloro-2-methylsulfanyl-1,3-benzothiazole;3,4-dimethylbenzenesulfonic acid?
The canonical SMILES for 5-chloro-2-methylsulfanyl-1,3-benzothiazole;3,4-dimethylbenzenesulfonic acid is CSc1nc2cc(Cl)ccc2s1.Cc1ccc(S(=O)(=O)O)cc1C.
What is the InChIKey of 5-chloro-2-methylsulfanyl-1,3-benzothiazole;3,4-dimethylbenzenesulfonic acid?
The InChIKey is VBIXDMYZOZMVQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNS2.C8H10O3S/c1-11-8-10-6-4-5(9)2-3-7(6)12-8;1-6-3-4-8(5-7(6)2)12(9,10)11/h2-4H,1H3;3-5H,1-2H3,(H,9,10,11).
What are the key properties of 5-chloro-2-methylsulfanyl-1,3-benzothiazole;3,4-dimethylbenzenesulfonic acid?
5-chloro-2-methylsulfanyl-1,3-benzothiazole;3,4-dimethylbenzenesulfonic acid has a molecular weight of 401.96 g/mol, XLogP of 5.22, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methylsulfanyl-1,3-benzothiazole;3,4-dimethylbenzenesulfonic acid is sourced from PubChem (CID 87614576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).