chloro(propyl)phosphinous acid

C3H8ClOP — CID 87614761

IUPACchloro(propyl)phosphinous acid
SMILESCCCP(O)Cl
InChIInChI=1S/C3H8ClOP/c1-2-3-6(4)5/h5H,2-3H2,1H3
InChIKeyVPODOQJADXNUSX-UHFFFAOYSA-N
MW126.52 g/mol
LogP1.94
Rot. Bonds2

About chloro(propyl)phosphinous acid

chloro(propyl)phosphinous acid (PubChem CID 87614761) has the molecular formula C3H8ClOP and a molecular weight of 126.52 g/mol. Its IUPAC name is chloro(propyl)phosphinous acid.

Molecular Properties

Compound Namechloro(propyl)phosphinous acid
PubChem CID87614761
Molecular FormulaC3H8ClOP
Molecular Weight126.52 g/mol
Exact Mass126.00
IUPAC Namechloro(propyl)phosphinous acid
SMILESCCCP(O)Cl
InChIInChI=1S/C3H8ClOP/c1-2-3-6(4)5/h5H,2-3H2,1H3
InChIKeyVPODOQJADXNUSX-UHFFFAOYSA-N
XLogP1.94
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500126.52
LogP ≤ 51.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze chloro(propyl)phosphinous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of chloro(propyl)phosphinous acid?
The IUPAC name of chloro(propyl)phosphinous acid (CID 87614761) is chloro(propyl)phosphinous acid.
What is the SMILES notation for chloro(propyl)phosphinous acid?
The canonical SMILES for chloro(propyl)phosphinous acid is CCCP(O)Cl.
What is the InChIKey of chloro(propyl)phosphinous acid?
The InChIKey is VPODOQJADXNUSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8ClOP/c1-2-3-6(4)5/h5H,2-3H2,1H3.
What are the key properties of chloro(propyl)phosphinous acid?
chloro(propyl)phosphinous acid has a molecular weight of 126.52 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(propyl)phosphinous acid is sourced from PubChem (CID 87614761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).