C26H34F2O6S2 — CID 87614793
2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonate;5-[2-(4-methylphenyl)ethyl]-6-oxa-1-thioniabicyclo[3.1.0]hexane (PubChem CID 87614793) has the molecular formula C26H34F2O6S2 and a molecular weight of 544.68 g/mol. Its IUPAC name is 2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonate;5-[2-(4-methylphenyl)ethyl]-6-oxa-1-thioniabicyclo[3.1.0]hexane.
| Compound Name | 2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonate;5-[2-(4-methylphenyl)ethyl]-6-oxa-1-thioniabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 87614793 |
| Molecular Formula | C26H34F2O6S2 |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonate;5-[2-(4-methylphenyl)ethyl]-6-oxa-1-thioniabicyclo[3.1.0]hexane |
| SMILES | Cc1ccc(CCC23CCC[S+]2O3)cc1.O=C(OCC12CC3CC(CC(C3)C1)C2)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C13H18F2O5S.C13H17OS/c14-13(15,21(17,18)19)11(16)20-7-12-4-8-1-9(5-12)3-10(2-8)6-12;1-11-3-5-12(6-4-11)7-9-13-8-2-10-15(13)14-13/h8-10H,1-7H2,(H,17,18,19);3-6H,2,7-10H2,1H3/q;+1/p-1 |
| InChIKey | NWPKAECXMHKOGH-UHFFFAOYSA-M |
| XLogP | 4.87 |
| TPSA | 96.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|