C27H31NO4 — CID 87614950
3-[(1R,12S,14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]-2-methyl-1-(4-methylphenyl)propan-1-one (PubChem CID 87614950) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 3-[(1R,12S,14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]-2-methyl-1-(4-methylphenyl)propan-1-one.
| Compound Name | 3-[(1R,12S,14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]-2-methyl-1-(4-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 87614950 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 3-[(1R,12S,14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-4-yl]-2-methyl-1-(4-methylphenyl)propan-1-one |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](O)C=C[C@]31CCN(CC(C)C(=O)c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C27H31NO4/c1-17-4-6-19(7-5-17)25(30)18(2)15-28-13-12-27-11-10-21(29)14-23(27)32-26-22(31-3)9-8-20(16-28)24(26)27/h4-11,18,21,23,29H,12-16H2,1-3H3/t18?,21-,23-,27+/m0/s1 |
| InChIKey | UMARMBAQEGJZMU-XKHKYGQESA-N |
| XLogP | 4.05 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|