C48H66Br4 — CID 87615037
1,3-dibutyl-5-(3,5-dibromophenyl)-7-[3,5-dibutyl-7-(3,5-dibromophenyl)-1-adamantyl]adamantane (PubChem CID 87615037) has the molecular formula C48H66Br4 and a molecular weight of 962.67 g/mol. Its IUPAC name is 1,3-dibutyl-5-(3,5-dibromophenyl)-7-[3,5-dibutyl-7-(3,5-dibromophenyl)-1-adamantyl]adamantane.
| Compound Name | 1,3-dibutyl-5-(3,5-dibromophenyl)-7-[3,5-dibutyl-7-(3,5-dibromophenyl)-1-adamantyl]adamantane |
|---|---|
| PubChem CID | 87615037 |
| Molecular Formula | C48H66Br4 |
| Molecular Weight | 962.67 g/mol |
| Exact Mass | 958.19 |
| IUPAC Name | 1,3-dibutyl-5-(3,5-dibromophenyl)-7-[3,5-dibutyl-7-(3,5-dibromophenyl)-1-adamantyl]adamantane |
| SMILES | CCCCC12CC3(CCCC)CC(c4cc(Br)cc(Br)c4)(C1)CC(C14CC5(CCCC)CC(CCCC)(CC(c6cc(Br)cc(Br)c6)(C5)C1)C4)(C2)C3 |
| InChI | InChI=1S/C48H66Br4/c1-5-9-13-41-23-42(14-10-6-2)26-45(25-41,35-17-37(49)21-38(50)18-35)33-47(29-41,30-42)48-31-43(15-11-7-3)24-44(32-48,16-12-8-4)28-46(27-43,34-48)36-19-39(51)22-40(52)20-36/h17-22H,5-16,23-34H2,1-4H3 |
| InChIKey | YWBUNJNJELNNBM-UHFFFAOYSA-N |
| XLogP | 17.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.67 |
| LogP ≤ 5 | 17.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |