C48H50Br4 — CID 87615058
1-[3,5-bis(4-bromo-2-methylphenyl)-1-adamantyl]-3,5-bis(4-bromo-2-methylphenyl)adamantane (PubChem CID 87615058) has the molecular formula C48H50Br4 and a molecular weight of 946.54 g/mol. Its IUPAC name is 1-[3,5-bis(4-bromo-2-methylphenyl)-1-adamantyl]-3,5-bis(4-bromo-2-methylphenyl)adamantane.
| Compound Name | 1-[3,5-bis(4-bromo-2-methylphenyl)-1-adamantyl]-3,5-bis(4-bromo-2-methylphenyl)adamantane |
|---|---|
| PubChem CID | 87615058 |
| Molecular Formula | C48H50Br4 |
| Molecular Weight | 946.54 g/mol |
| Exact Mass | 942.06 |
| IUPAC Name | 1-[3,5-bis(4-bromo-2-methylphenyl)-1-adamantyl]-3,5-bis(4-bromo-2-methylphenyl)adamantane |
| SMILES | Cc1cc(Br)ccc1C12CC3CC(c4ccc(Br)cc4C)(C1)CC(C14CC5CC(c6ccc(Br)cc6C)(CC(c6ccc(Br)cc6C)(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C48H50Br4/c1-29-13-35(49)5-9-39(29)43-17-33-18-44(23-43,40-10-6-36(50)14-30(40)2)26-47(21-33,25-43)48-22-34-19-45(27-48,41-11-7-37(51)15-31(41)3)24-46(20-34,28-48)42-12-8-38(52)16-32(42)4/h5-16,33-34H,17-28H2,1-4H3 |
| InChIKey | LJADRIYOIYCAOO-UHFFFAOYSA-N |
| XLogP | 14.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.54 |
| LogP ≤ 5 | 14.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |