C12H11Cl2FN2O — CID 87615479
N-[(5,6-dichloro-3-pyridinyl)methyl]-N-(2-fluoroethyl)furan-3-amine (PubChem CID 87615479) has the molecular formula C12H11Cl2FN2O and a molecular weight of 289.14 g/mol. Its IUPAC name is N-[(5,6-dichloro-3-pyridinyl)methyl]-N-(2-fluoroethyl)furan-3-amine.
| Compound Name | N-[(5,6-dichloro-3-pyridinyl)methyl]-N-(2-fluoroethyl)furan-3-amine |
|---|---|
| PubChem CID | 87615479 |
| Molecular Formula | C12H11Cl2FN2O |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | N-[(5,6-dichloro-3-pyridinyl)methyl]-N-(2-fluoroethyl)furan-3-amine |
| SMILES | FCCN(Cc1cnc(Cl)c(Cl)c1)c1ccoc1 |
| InChI | InChI=1S/C12H11Cl2FN2O/c13-11-5-9(6-16-12(11)14)7-17(3-2-15)10-1-4-18-8-10/h1,4-6,8H,2-3,7H2 |
| InChIKey | RVEYWIRZYGVKDX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|