C21H54N2O3Si4 — CID 87615570
N-(3-trimethoxysilylpropyl)-N,N',N'-tris(trimethylsilyl)hexane-1,6-diamine (PubChem CID 87615570) has the molecular formula C21H54N2O3Si4 and a molecular weight of 495.02 g/mol. Its IUPAC name is N-(3-trimethoxysilylpropyl)-N,N',N'-tris(trimethylsilyl)hexane-1,6-diamine.
| Compound Name | N-(3-trimethoxysilylpropyl)-N,N',N'-tris(trimethylsilyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 87615570 |
| Molecular Formula | C21H54N2O3Si4 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | N-(3-trimethoxysilylpropyl)-N,N',N'-tris(trimethylsilyl)hexane-1,6-diamine |
| SMILES | CO[Si](CCCN(CCCCCCN([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)(OC)OC |
| InChI | InChI=1S/C21H54N2O3Si4/c1-24-30(25-2,26-3)21-17-19-22(27(4,5)6)18-15-13-14-16-20-23(28(7,8)9)29(10,11)12/h13-21H2,1-12H3 |
| InChIKey | CKRGBMRPTWEYPS-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|