C23H25F2N3O2 — CID 87615663
N-[(2S)-6-amino-1-[4-(2,5-difluorophenyl)-2-phenyl-2,5-dihydropyrrol-1-yl]-1-oxohexan-2-yl]formamide (PubChem CID 87615663) has the molecular formula C23H25F2N3O2 and a molecular weight of 413.47 g/mol. Its IUPAC name is N-[(2S)-6-amino-1-[4-(2,5-difluorophenyl)-2-phenyl-2,5-dihydropyrrol-1-yl]-1-oxohexan-2-yl]formamide.
| Compound Name | N-[(2S)-6-amino-1-[4-(2,5-difluorophenyl)-2-phenyl-2,5-dihydropyrrol-1-yl]-1-oxohexan-2-yl]formamide |
|---|---|
| PubChem CID | 87615663 |
| Molecular Formula | C23H25F2N3O2 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-[(2S)-6-amino-1-[4-(2,5-difluorophenyl)-2-phenyl-2,5-dihydropyrrol-1-yl]-1-oxohexan-2-yl]formamide |
| SMILES | NCCCC[C@H](NC=O)C(=O)N1CC(c2cc(F)ccc2F)=CC1c1ccccc1 |
| InChI | InChI=1S/C23H25F2N3O2/c24-18-9-10-20(25)19(13-18)17-12-22(16-6-2-1-3-7-16)28(14-17)23(30)21(27-15-29)8-4-5-11-26/h1-3,6-7,9-10,12-13,15,21-22H,4-5,8,11,14,26H2,(H,27,29)/t21-,22?/m0/s1 |
| InChIKey | HYYREMDHCGYZFN-HMTLIYDFSA-N |
| XLogP | 3.18 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|