C21H18ClN3O8 — CID 87615672
ethyl 2-[6-acetyloxy-1-(4-chlorophenyl)-2-methyl-5,7-dinitroindol-3-yl]acetate (PubChem CID 87615672) has the molecular formula C21H18ClN3O8 and a molecular weight of 475.84 g/mol. Its IUPAC name is ethyl 2-[6-acetyloxy-1-(4-chlorophenyl)-2-methyl-5,7-dinitroindol-3-yl]acetate.
| Compound Name | ethyl 2-[6-acetyloxy-1-(4-chlorophenyl)-2-methyl-5,7-dinitroindol-3-yl]acetate |
|---|---|
| PubChem CID | 87615672 |
| Molecular Formula | C21H18ClN3O8 |
| Molecular Weight | 475.84 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | ethyl 2-[6-acetyloxy-1-(4-chlorophenyl)-2-methyl-5,7-dinitroindol-3-yl]acetate |
| SMILES | CCOC(=O)Cc1c(C)n(-c2ccc(Cl)cc2)c2c([N+](=O)[O-])c(OC(C)=O)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C21H18ClN3O8/c1-4-32-18(27)10-15-11(2)23(14-7-5-13(22)6-8-14)19-16(15)9-17(24(28)29)21(33-12(3)26)20(19)25(30)31/h5-9H,4,10H2,1-3H3 |
| InChIKey | JHPUFHZPVDMMAN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 143.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.84 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|