C24H24Br2F12 — CID 87616025
1-bromo-3-[3-bromo-5,7-bis(trifluoromethyl)-1-adamantyl]-5,7-bis(trifluoromethyl)adamantane (PubChem CID 87616025) has the molecular formula C24H24Br2F12 and a molecular weight of 700.24 g/mol. Its IUPAC name is 1-bromo-3-[3-bromo-5,7-bis(trifluoromethyl)-1-adamantyl]-5,7-bis(trifluoromethyl)adamantane.
| Compound Name | 1-bromo-3-[3-bromo-5,7-bis(trifluoromethyl)-1-adamantyl]-5,7-bis(trifluoromethyl)adamantane |
|---|---|
| PubChem CID | 87616025 |
| Molecular Formula | C24H24Br2F12 |
| Molecular Weight | 700.24 g/mol |
| Exact Mass | 698.01 |
| IUPAC Name | 1-bromo-3-[3-bromo-5,7-bis(trifluoromethyl)-1-adamantyl]-5,7-bis(trifluoromethyl)adamantane |
| SMILES | FC(F)(F)C12CC3(Br)CC(C(F)(F)F)(C1)CC(C14CC5(Br)CC(C(F)(F)F)(CC(C(F)(F)F)(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C24H24Br2F12/c25-19-7-13(1-15(9-19,21(27,28)29)5-16(2-13,10-19)22(30,31)32)14-3-17(23(33,34)35)6-18(4-14,24(36,37)38)12-20(26,8-14)11-17/h1-12H2 |
| InChIKey | ODQIIWYOAPVHQJ-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.24 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|