C52H50Cl2N2PRu+ — CID 87616279
[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-fluoren-9-ylideneruthenium;triphenylphosphanium (PubChem CID 87616279) has the molecular formula C52H50Cl2N2PRu+ and a molecular weight of 905.94 g/mol. Its IUPAC name is [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-fluoren-9-ylideneruthenium;triphenylphosphanium.
| Compound Name | [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-fluoren-9-ylideneruthenium;triphenylphosphanium |
|---|---|
| PubChem CID | 87616279 |
| Molecular Formula | C52H50Cl2N2PRu+ |
| Molecular Weight | 905.94 g/mol |
| Exact Mass | 905.21 |
| IUPAC Name | [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-fluoren-9-ylideneruthenium;triphenylphosphanium |
| SMILES | Cc1cc(C)c(N2CCN(c3c(C)cc(C)cc3C)C2=[Ru](Cl)(Cl)=C2c3ccccc3-c3ccccc32)c(C)c1.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H26N2.C18H15P.C13H8.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;;;/h9-12H,7-8H2,1-6H3;1-15H;1-8H;2*1H;/q;;;;;+2/p-1 |
| InChIKey | SMVFFSGLWHIGQA-UHFFFAOYSA-M |
| XLogP | 11.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.94 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|