C58H54F6N12O2 — CID 87616950
3-[2-(3H-imidazo[4,5-c]pyridin-7-yl)ethynyl]-4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 87616950) has the molecular formula C58H54F6N12O2 and a molecular weight of 1065.14 g/mol. Its IUPAC name is 3-[2-(3H-imidazo[4,5-c]pyridin-7-yl)ethynyl]-4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[2-(3H-imidazo[4,5-c]pyridin-7-yl)ethynyl]-4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 87616950 |
| Molecular Formula | C58H54F6N12O2 |
| Molecular Weight | 1065.14 g/mol |
| Exact Mass | 1064.44 |
| IUPAC Name | 3-[2-(3H-imidazo[4,5-c]pyridin-7-yl)ethynyl]-4-methyl-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CN3CCN(C)CC3)c(C(F)(F)F)c2)cc1C#Cc1cncc2[nH]cnc12.Cc1ccc(C(=O)Nc2ccc(CN3CCN(C)CC3)c(C(F)(F)F)c2)cc1C#Cc1cncc2[nH]cnc12 |
| InChI | InChI=1S/2C29H27F3N6O/c2*1-19-3-4-21(13-20(19)5-6-22-15-33-16-26-27(22)35-18-34-26)28(39)36-24-8-7-23(25(14-24)29(30,31)32)17-38-11-9-37(2)10-12-38/h2*3-4,7-8,13-16,18H,9-12,17H2,1-2H3,(H,34,35)(H,36,39) |
| InChIKey | UTJZNSNYCYYALQ-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.14 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|