C24H35F3N4O3 — CID 87617114
N'-[4-(dimethylamino)-4-[(4-methylphenyl)methyl]cyclohexyl]-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]butanediamide (PubChem CID 87617114) has the molecular formula C24H35F3N4O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is N'-[4-(dimethylamino)-4-[(4-methylphenyl)methyl]cyclohexyl]-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]butanediamide.
| Compound Name | N'-[4-(dimethylamino)-4-[(4-methylphenyl)methyl]cyclohexyl]-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]butanediamide |
|---|---|
| PubChem CID | 87617114 |
| Molecular Formula | C24H35F3N4O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | N'-[4-(dimethylamino)-4-[(4-methylphenyl)methyl]cyclohexyl]-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]butanediamide |
| SMILES | Cc1ccc(CC2(N(C)C)CCC(NC(=O)CCC(=O)NCCNC(=O)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C24H35F3N4O3/c1-17-4-6-18(7-5-17)16-23(31(2)3)12-10-19(11-13-23)30-21(33)9-8-20(32)28-14-15-29-22(34)24(25,26)27/h4-7,19H,8-16H2,1-3H3,(H,28,32)(H,29,34)(H,30,33) |
| InChIKey | FQXBFTNSNNFFFG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|