About 1-decylsulfinylethanol
1-decylsulfinylethanol (PubChem CID 87617224) has the molecular formula C12H26O2S
and a molecular weight of 234.40 g/mol. Its IUPAC name is 1-decylsulfinylethanol.
Molecular Properties
| Compound Name | 1-decylsulfinylethanol |
| PubChem CID | 87617224 |
| Molecular Formula | C12H26O2S |
| Molecular Weight | 234.40 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1-decylsulfinylethanol |
| SMILES | CCCCCCCCCCS(=O)C(C)O |
| InChI | InChI=1S/C12H26O2S/c1-3-4-5-6-7-8-9-10-11-15(14)12(2)13/h12-13H,3-11H2,1-2H3 |
| InChIKey | PGPYBYDBFPLBRJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-decylsulfinylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decylsulfinylethanol?
The IUPAC name of 1-decylsulfinylethanol (CID 87617224) is 1-decylsulfinylethanol.
What is the SMILES notation for 1-decylsulfinylethanol?
The canonical SMILES for 1-decylsulfinylethanol is CCCCCCCCCCS(=O)C(C)O.
What is the InChIKey of 1-decylsulfinylethanol?
The InChIKey is PGPYBYDBFPLBRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O2S/c1-3-4-5-6-7-8-9-10-11-15(14)12(2)13/h12-13H,3-11H2,1-2H3.
What are the key properties of 1-decylsulfinylethanol?
1-decylsulfinylethanol has a molecular weight of 234.40 g/mol, XLogP of 3.21, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decylsulfinylethanol is sourced from PubChem (CID 87617224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).