C29H29F3N4O3 — CID 87617670
N-[1'-[[4-[(E)-C-(3,4-difluorophenyl)-N-(2-fluoroethoxy)carbonimidoyl]phenyl]methyl]spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-yl]acetamide (PubChem CID 87617670) has the molecular formula C29H29F3N4O3 and a molecular weight of 538.57 g/mol. Its IUPAC name is N-[1'-[[4-[(E)-C-(3,4-difluorophenyl)-N-(2-fluoroethoxy)carbonimidoyl]phenyl]methyl]spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-yl]acetamide.
| Compound Name | N-[1'-[[4-[(E)-C-(3,4-difluorophenyl)-N-(2-fluoroethoxy)carbonimidoyl]phenyl]methyl]spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-yl]acetamide |
|---|---|
| PubChem CID | 87617670 |
| Molecular Formula | C29H29F3N4O3 |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | N-[1'-[[4-[(E)-C-(3,4-difluorophenyl)-N-(2-fluoroethoxy)carbonimidoyl]phenyl]methyl]spiro[1H-furo[3,4-c]pyridine-3,4'-piperidine]-6-yl]acetamide |
| SMILES | CC(=O)Nc1cc2c(cn1)C1(CCN(Cc3ccc(/C(=N\OCCF)c4ccc(F)c(F)c4)cc3)CC1)OC2 |
| InChI | InChI=1S/C29H29F3N4O3/c1-19(37)34-27-15-23-18-38-29(24(23)16-33-27)8-11-36(12-9-29)17-20-2-4-21(5-3-20)28(35-39-13-10-30)22-6-7-25(31)26(32)14-22/h2-7,14-16H,8-13,17-18H2,1H3,(H,33,34,37)/b35-28+ |
| InChIKey | FGWREOUWYQZGMZ-AWQADKOQSA-N |
| XLogP | 5.08 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|