C18H23F5O7S — CID 87617946
3-(2-cyclohexyl-1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)oxycarbonylbicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 87617946) has the molecular formula C18H23F5O7S and a molecular weight of 478.43 g/mol. Its IUPAC name is 3-(2-cyclohexyl-1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)oxycarbonylbicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 3-(2-cyclohexyl-1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)oxycarbonylbicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 87617946 |
| Molecular Formula | C18H23F5O7S |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 3-(2-cyclohexyl-1,1,1,3,3-pentafluoro-3-sulfopropan-2-yl)oxycarbonylbicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(O)C1C2CCC(C2)C1C(=O)OC(C1CCCCC1)(C(F)(F)F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C18H23F5O7S/c19-17(20,21)16(11-4-2-1-3-5-11,18(22,23)31(27,28)29)30-15(26)13-10-7-6-9(8-10)12(13)14(24)25/h9-13H,1-8H2,(H,24,25)(H,27,28,29) |
| InChIKey | VUXXLELAEJJHOS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|