About bis(4,4,4-trifluorobutyl azepine-1-carboxylate);hydrochloride
bis(4,4,4-trifluorobutyl azepine-1-carboxylate);hydrochloride (PubChem CID 87617952) has the molecular formula C22H25ClF6N2O4
and a molecular weight of 530.89 g/mol. Its IUPAC name is bis(4,4,4-trifluorobutyl azepine-1-carboxylate);hydrochloride.
Molecular Properties
| Compound Name | bis(4,4,4-trifluorobutyl azepine-1-carboxylate);hydrochloride |
| PubChem CID | 87617952 |
| Molecular Formula | C22H25ClF6N2O4 |
| Molecular Weight | 530.89 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | bis(4,4,4-trifluorobutyl azepine-1-carboxylate);hydrochloride |
| SMILES | Cl.O=C(OCCCC(F)(F)F)N1C=CC=CC=C1.O=C(OCCCC(F)(F)F)N1C=CC=CC=C1 |
| InChI | InChI=1S/2C11H12F3NO2.ClH/c2*12-11(13,14)6-5-9-17-10(16)15-7-3-1-2-4-8-15;/h2*1-4,7-8H,5-6,9H2;1H |
| InChIKey | SWUVCMUERJSWQE-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.89 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(4,4,4-trifluorobutyl azepine-1-carboxylate);hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4,4,4-trifluorobutyl azepine-1-carboxylate);hydrochloride?
The IUPAC name of bis(4,4,4-trifluorobutyl azepine-1-carboxylate);hydrochloride (CID 87617952) is bis(4,4,4-trifluorobutyl azepine-1-carboxylate);hydrochloride.
What is the SMILES notation for bis(4,4,4-trifluorobutyl azepine-1-carboxylate);hydrochloride?
The canonical SMILES for bis(4,4,4-trifluorobutyl azepine-1-carboxylate);hydrochloride is Cl.O=C(OCCCC(F)(F)F)N1C=CC=CC=C1.O=C(OCCCC(F)(F)F)N1C=CC=CC=C1.
What is the InChIKey of bis(4,4,4-trifluorobutyl azepine-1-carboxylate);hydrochloride?
The InChIKey is SWUVCMUERJSWQE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H12F3NO2.ClH/c2*12-11(13,14)6-5-9-17-10(16)15-7-3-1-2-4-8-15;/h2*1-4,7-8H,5-6,9H2;1H.
What are the key properties of bis(4,4,4-trifluorobutyl azepine-1-carboxylate);hydrochloride?
bis(4,4,4-trifluorobutyl azepine-1-carboxylate);hydrochloride has a molecular weight of 530.89 g/mol, XLogP of 7.15, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4,4,4-trifluorobutyl azepine-1-carboxylate);hydrochloride is sourced from PubChem (CID 87617952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).