C60H42F6N2O2 — CID 87618131
1-N,6-N-di(dibenzofuran-4-yl)-3,8-di(propan-2-yl)-1-N,6-N-bis[4-(trifluoromethyl)phenyl]pyrene-1,6-diamine (PubChem CID 87618131) has the molecular formula C60H42F6N2O2 and a molecular weight of 937.00 g/mol. Its IUPAC name is 1-N,6-N-di(dibenzofuran-4-yl)-3,8-di(propan-2-yl)-1-N,6-N-bis[4-(trifluoromethyl)phenyl]pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-di(dibenzofuran-4-yl)-3,8-di(propan-2-yl)-1-N,6-N-bis[4-(trifluoromethyl)phenyl]pyrene-1,6-diamine |
|---|---|
| PubChem CID | 87618131 |
| Molecular Formula | C60H42F6N2O2 |
| Molecular Weight | 937.00 g/mol |
| Exact Mass | 936.32 |
| IUPAC Name | 1-N,6-N-di(dibenzofuran-4-yl)-3,8-di(propan-2-yl)-1-N,6-N-bis[4-(trifluoromethyl)phenyl]pyrene-1,6-diamine |
| SMILES | CC(C)c1cc(N(c2ccc(C(F)(F)F)cc2)c2cccc3c2oc2ccccc23)c2ccc3c(C(C)C)cc(N(c4ccc(C(F)(F)F)cc4)c4cccc5c4oc4ccccc45)c4ccc1c2c34 |
| InChI | InChI=1S/C60H42F6N2O2/c1-33(2)47-31-51(67(37-23-19-35(20-24-37)59(61,62)63)49-15-9-13-43-39-11-5-7-17-53(39)69-57(43)49)45-30-28-42-48(34(3)4)32-52(46-29-27-41(47)55(45)56(42)46)68(38-25-21-36(22-26-38)60(64,65)66)50-16-10-14-44-40-12-6-8-18-54(40)70-58(44)50/h5-34H,1-4H3 |
| InChIKey | IACOLDWKOCYKSR-UHFFFAOYSA-N |
| XLogP | 19.61 |
| TPSA | 32.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.00 |
| LogP ≤ 5 | 19.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|