C36H39N3O6 — CID 87618385
(2,5-dioxopyrrolidin-1-yl) 6-[[2-(3-ethylimino-2,6,7-trimethylxanthen-9-yl)benzoyl]-methylamino]hexanoate (PubChem CID 87618385) has the molecular formula C36H39N3O6 and a molecular weight of 609.72 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[[2-(3-ethylimino-2,6,7-trimethylxanthen-9-yl)benzoyl]-methylamino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[[2-(3-ethylimino-2,6,7-trimethylxanthen-9-yl)benzoyl]-methylamino]hexanoate |
|---|---|
| PubChem CID | 87618385 |
| Molecular Formula | C36H39N3O6 |
| Molecular Weight | 609.72 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[[2-(3-ethylimino-2,6,7-trimethylxanthen-9-yl)benzoyl]-methylamino]hexanoate |
| SMILES | CC/N=c1\cc2oc3cc(C)c(C)cc3c(-c3ccccc3C(=O)N(C)CCCCCC(=O)ON3C(=O)CCC3=O)c-2cc1C |
| InChI | InChI=1S/C36H39N3O6/c1-6-37-29-21-31-28(19-24(29)4)35(27-18-22(2)23(3)20-30(27)44-31)25-12-9-10-13-26(25)36(43)38(5)17-11-7-8-14-34(42)45-39-32(40)15-16-33(39)41/h9-10,12-13,18-21H,6-8,11,14-17H2,1-5H3/b37-29+ |
| InChIKey | CVBVLPGMSLEBNN-SMTCOIIISA-N |
| XLogP | 6.29 |
| TPSA | 109.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.72 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|