C16H20F6N4O10 — CID 87618645
(2S)-2-[[(2S)-2-[[2-[[(2S,3S)-2-amino-3-hydroxybutanoyl]amino]acetyl]amino]-3-(2,2,2-trifluoroacetyl)oxypropanoyl]amino]-3-(2,2,2-trifluoroacetyl)oxypropanoic acid (PubChem CID 87618645) has the molecular formula C16H20F6N4O10 and a molecular weight of 542.34 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[2-[[(2S,3S)-2-amino-3-hydroxybutanoyl]amino]acetyl]amino]-3-(2,2,2-trifluoroacetyl)oxypropanoyl]amino]-3-(2,2,2-trifluoroacetyl)oxypropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[2-[[(2S,3S)-2-amino-3-hydroxybutanoyl]amino]acetyl]amino]-3-(2,2,2-trifluoroacetyl)oxypropanoyl]amino]-3-(2,2,2-trifluoroacetyl)oxypropanoic acid |
|---|---|
| PubChem CID | 87618645 |
| Molecular Formula | C16H20F6N4O10 |
| Molecular Weight | 542.34 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-[[(2S,3S)-2-amino-3-hydroxybutanoyl]amino]acetyl]amino]-3-(2,2,2-trifluoroacetyl)oxypropanoyl]amino]-3-(2,2,2-trifluoroacetyl)oxypropanoic acid |
| SMILES | C[C@H](O)[C@H](N)C(=O)NCC(=O)N[C@@H](COC(=O)C(F)(F)F)C(=O)N[C@@H](COC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C16H20F6N4O10/c1-5(27)9(23)11(30)24-2-8(28)25-6(3-35-13(33)15(17,18)19)10(29)26-7(12(31)32)4-36-14(34)16(20,21)22/h5-7,9,27H,2-4,23H2,1H3,(H,24,30)(H,25,28)(H,26,29)(H,31,32)/t5-,6-,7-,9-/m0/s1 |
| InChIKey | KYQNKXJMNCQRHT-AZRUVXNYSA-N |
| XLogP | -2.92 |
| TPSA | 223.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.34 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |