C20H18BrClN2O3 — CID 87618663
(2'S,3S,4'E,6'S)-6-bromo-2'-(3-chlorophenyl)-4'-hydroxyimino-6'-methoxyspiro[1H-indole-3,1'-cyclohexane]-2-one (PubChem CID 87618663) has the molecular formula C20H18BrClN2O3 and a molecular weight of 449.73 g/mol. Its IUPAC name is (2'S,3S,4'E,6'S)-6-bromo-2'-(3-chlorophenyl)-4'-hydroxyimino-6'-methoxyspiro[1H-indole-3,1'-cyclohexane]-2-one.
| Compound Name | (2'S,3S,4'E,6'S)-6-bromo-2'-(3-chlorophenyl)-4'-hydroxyimino-6'-methoxyspiro[1H-indole-3,1'-cyclohexane]-2-one |
|---|---|
| PubChem CID | 87618663 |
| Molecular Formula | C20H18BrClN2O3 |
| Molecular Weight | 449.73 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | (2'S,3S,4'E,6'S)-6-bromo-2'-(3-chlorophenyl)-4'-hydroxyimino-6'-methoxyspiro[1H-indole-3,1'-cyclohexane]-2-one |
| SMILES | CO[C@H]1C/C(=N/O)C[C@@H](c2cccc(Cl)c2)[C@@]12C(=O)Nc1cc(Br)ccc12 |
| InChI | InChI=1S/C20H18BrClN2O3/c1-27-18-10-14(24-26)9-16(11-3-2-4-13(22)7-11)20(18)15-6-5-12(21)8-17(15)23-19(20)25/h2-8,16,18,26H,9-10H2,1H3,(H,23,25)/b24-14+/t16-,18-,20+/m0/s1 |
| InChIKey | DGAOBZFXODJKJB-IUUOYQSTSA-N |
| XLogP | 4.72 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.73 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|