About 3H-cyclopenta[a]naphthalen-3-ide;hafnium;dichloride
3H-cyclopenta[a]naphthalen-3-ide;hafnium;dichloride (PubChem CID 87618758) has the molecular formula C13H9Cl2Hf-3
and a molecular weight of 414.61 g/mol. Its IUPAC name is 3H-cyclopenta[a]naphthalen-3-ide;hafnium;dichloride.
Molecular Properties
| Compound Name | 3H-cyclopenta[a]naphthalen-3-ide;hafnium;dichloride |
| PubChem CID | 87618758 |
| Molecular Formula | C13H9Cl2Hf-3 |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.96 |
| IUPAC Name | 3H-cyclopenta[a]naphthalen-3-ide;hafnium;dichloride |
| SMILES | [Cl-].[Cl-].[Hf].c1ccc2c(c1)ccc1[cH-]ccc12 |
| InChI | InChI=1S/C13H9.2ClH.Hf/c1-2-6-12-10(4-1)8-9-11-5-3-7-13(11)12;;;/h1-9H;2*1H;/q-1;;;/p-2 |
| InChIKey | AKUOLNNRNQZCCD-UHFFFAOYSA-L |
| XLogP | -2.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3H-cyclopenta[a]naphthalen-3-ide;hafnium;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-cyclopenta[a]naphthalen-3-ide;hafnium;dichloride?
The IUPAC name of 3H-cyclopenta[a]naphthalen-3-ide;hafnium;dichloride (CID 87618758) is 3H-cyclopenta[a]naphthalen-3-ide;hafnium;dichloride.
What is the SMILES notation for 3H-cyclopenta[a]naphthalen-3-ide;hafnium;dichloride?
The canonical SMILES for 3H-cyclopenta[a]naphthalen-3-ide;hafnium;dichloride is [Cl-].[Cl-].[Hf].c1ccc2c(c1)ccc1[cH-]ccc12.
What is the InChIKey of 3H-cyclopenta[a]naphthalen-3-ide;hafnium;dichloride?
The InChIKey is AKUOLNNRNQZCCD-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H9.2ClH.Hf/c1-2-6-12-10(4-1)8-9-11-5-3-7-13(11)12;;;/h1-9H;2*1H;/q-1;;;/p-2.
What are the key properties of 3H-cyclopenta[a]naphthalen-3-ide;hafnium;dichloride?
3H-cyclopenta[a]naphthalen-3-ide;hafnium;dichloride has a molecular weight of 414.61 g/mol, XLogP of -2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-cyclopenta[a]naphthalen-3-ide;hafnium;dichloride is sourced from PubChem (CID 87618758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).