C27H27NO4 — CID 87619035
(3aR,6E,10Z,11aR)-10-methyl-3-methylidene-2-oxo-N-(4-phenoxyphenyl)-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxamide (PubChem CID 87619035) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is (3aR,6E,10Z,11aR)-10-methyl-3-methylidene-2-oxo-N-(4-phenoxyphenyl)-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxamide.
| Compound Name | (3aR,6E,10Z,11aR)-10-methyl-3-methylidene-2-oxo-N-(4-phenoxyphenyl)-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxamide |
|---|---|
| PubChem CID | 87619035 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (3aR,6E,10Z,11aR)-10-methyl-3-methylidene-2-oxo-N-(4-phenoxyphenyl)-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxamide |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(/C)CC/C=C(/C(=O)Nc3ccc(Oc4ccccc4)cc3)CC[C@H]12 |
| InChI | InChI=1S/C27H27NO4/c1-18-7-6-8-20(11-16-24-19(2)27(30)32-25(24)17-18)26(29)28-21-12-14-23(15-13-21)31-22-9-4-3-5-10-22/h3-5,8-10,12-15,17,24-25H,2,6-7,11,16H2,1H3,(H,28,29)/b18-17-,20-8+/t24-,25-/m1/s1 |
| InChIKey | MCSMPBRCBSDCMJ-XAEOEWTOSA-N |
| XLogP | 5.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|