About [(3,5-dibromo-4-hydroxyanilino)-phosphonomethyl]phosphonic acid
[(3,5-dibromo-4-hydroxyanilino)-phosphonomethyl]phosphonic acid (PubChem CID 87619509) has the molecular formula C7H9Br2NO7P2
and a molecular weight of 440.91 g/mol. Its IUPAC name is [(3,5-dibromo-4-hydroxyanilino)-phosphonomethyl]phosphonic acid.
Molecular Properties
| Compound Name | [(3,5-dibromo-4-hydroxyanilino)-phosphonomethyl]phosphonic acid |
| PubChem CID | 87619509 |
| Molecular Formula | C7H9Br2NO7P2 |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 438.82 |
| IUPAC Name | [(3,5-dibromo-4-hydroxyanilino)-phosphonomethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(Nc1cc(Br)c(O)c(Br)c1)P(=O)(O)O |
| InChI | InChI=1S/C7H9Br2NO7P2/c8-4-1-3(2-5(9)6(4)11)10-7(18(12,13)14)19(15,16)17/h1-2,7,10-11H,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | CUNKCOQPFXMRTL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(3,5-dibromo-4-hydroxyanilino)-phosphonomethyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3,5-dibromo-4-hydroxyanilino)-phosphonomethyl]phosphonic acid?
The IUPAC name of [(3,5-dibromo-4-hydroxyanilino)-phosphonomethyl]phosphonic acid (CID 87619509) is [(3,5-dibromo-4-hydroxyanilino)-phosphonomethyl]phosphonic acid.
What is the SMILES notation for [(3,5-dibromo-4-hydroxyanilino)-phosphonomethyl]phosphonic acid?
The canonical SMILES for [(3,5-dibromo-4-hydroxyanilino)-phosphonomethyl]phosphonic acid is O=P(O)(O)C(Nc1cc(Br)c(O)c(Br)c1)P(=O)(O)O.
What is the InChIKey of [(3,5-dibromo-4-hydroxyanilino)-phosphonomethyl]phosphonic acid?
The InChIKey is CUNKCOQPFXMRTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Br2NO7P2/c8-4-1-3(2-5(9)6(4)11)10-7(18(12,13)14)19(15,16)17/h1-2,7,10-11H,(H2,12,13,14)(H2,15,16,17).
What are the key properties of [(3,5-dibromo-4-hydroxyanilino)-phosphonomethyl]phosphonic acid?
[(3,5-dibromo-4-hydroxyanilino)-phosphonomethyl]phosphonic acid has a molecular weight of 440.91 g/mol, XLogP of 1.97, 4 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3,5-dibromo-4-hydroxyanilino)-phosphonomethyl]phosphonic acid is sourced from PubChem (CID 87619509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).