C23H13Cl3F3N3O2 — CID 87619544
2-[5-chloro-1-[(2,4-dichlorophenyl)methyl]-2-(trifluoromethyl)indol-3-yl]-2-oxo-N-pyridin-2-ylacetamide (PubChem CID 87619544) has the molecular formula C23H13Cl3F3N3O2 and a molecular weight of 526.73 g/mol. Its IUPAC name is 2-[5-chloro-1-[(2,4-dichlorophenyl)methyl]-2-(trifluoromethyl)indol-3-yl]-2-oxo-N-pyridin-2-ylacetamide.
| Compound Name | 2-[5-chloro-1-[(2,4-dichlorophenyl)methyl]-2-(trifluoromethyl)indol-3-yl]-2-oxo-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 87619544 |
| Molecular Formula | C23H13Cl3F3N3O2 |
| Molecular Weight | 526.73 g/mol |
| Exact Mass | 525.00 |
| IUPAC Name | 2-[5-chloro-1-[(2,4-dichlorophenyl)methyl]-2-(trifluoromethyl)indol-3-yl]-2-oxo-N-pyridin-2-ylacetamide |
| SMILES | O=C(Nc1ccccn1)C(=O)c1c(C(F)(F)F)n(Cc2ccc(Cl)cc2Cl)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C23H13Cl3F3N3O2/c24-13-6-7-17-15(9-13)19(20(33)22(34)31-18-3-1-2-8-30-18)21(23(27,28)29)32(17)11-12-4-5-14(25)10-16(12)26/h1-10H,11H2,(H,30,31,34) |
| InChIKey | YGOOKJKJLGCWFG-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.73 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|