C17H25ClN2O — CID 87619863
N-chloro-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide (PubChem CID 87619863) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is N-chloro-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide.
| Compound Name | N-chloro-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 87619863 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-chloro-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
| SMILES | CC1(C)CC(N(Cl)C(=O)Cc2ccccc2)CC(C)(C)N1 |
| InChI | InChI=1S/C17H25ClN2O/c1-16(2)11-14(12-17(3,4)19-16)20(18)15(21)10-13-8-6-5-7-9-13/h5-9,14,19H,10-12H2,1-4H3 |
| InChIKey | TZJUUFKSLXWZFJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|