C31H35F3NO2+ — CID 87620561
1-[2-(4-tert-butylphenyl)ethyl]-6,7-dimethoxy-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydroisoquinolin-2-ium (PubChem CID 87620561) has the molecular formula C31H35F3NO2+ and a molecular weight of 510.62 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)ethyl]-6,7-dimethoxy-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydroisoquinolin-2-ium.
| Compound Name | 1-[2-(4-tert-butylphenyl)ethyl]-6,7-dimethoxy-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 87620561 |
| Molecular Formula | C31H35F3NO2+ |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)ethyl]-6,7-dimethoxy-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydroisoquinolin-2-ium |
| SMILES | COc1cc2c(cc1OC)C(CCc1ccc(C(C)(C)C)cc1)=[N+](Cc1ccc(C(F)(F)F)cc1)CC2 |
| InChI | InChI=1S/C31H35F3NO2/c1-30(2,3)24-11-6-21(7-12-24)10-15-27-26-19-29(37-5)28(36-4)18-23(26)16-17-35(27)20-22-8-13-25(14-9-22)31(32,33)34/h6-9,11-14,18-19H,10,15-17,20H2,1-5H3/q+1 |
| InChIKey | JTERYQXBFJGWAS-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|