About [(3-phenyl-1,2-oxazol-5-yl)amino]methyl 4-carbonochloridoylbenzoate
[(3-phenyl-1,2-oxazol-5-yl)amino]methyl 4-carbonochloridoylbenzoate (PubChem CID 87620603) has the molecular formula C18H13ClN2O4
and a molecular weight of 356.77 g/mol. Its IUPAC name is [(3-phenyl-1,2-oxazol-5-yl)amino]methyl 4-carbonochloridoylbenzoate.
Molecular Properties
| Compound Name | [(3-phenyl-1,2-oxazol-5-yl)amino]methyl 4-carbonochloridoylbenzoate |
| PubChem CID | 87620603 |
| Molecular Formula | C18H13ClN2O4 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | [(3-phenyl-1,2-oxazol-5-yl)amino]methyl 4-carbonochloridoylbenzoate |
| SMILES | O=C(Cl)c1ccc(C(=O)OCNc2cc(-c3ccccc3)no2)cc1 |
| InChI | InChI=1S/C18H13ClN2O4/c19-17(22)13-6-8-14(9-7-13)18(23)24-11-20-16-10-15(21-25-16)12-4-2-1-3-5-12/h1-10,20H,11H2 |
| InChIKey | QTSDFXGOSHBBMV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(3-phenyl-1,2-oxazol-5-yl)amino]methyl 4-carbonochloridoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3-phenyl-1,2-oxazol-5-yl)amino]methyl 4-carbonochloridoylbenzoate?
The IUPAC name of [(3-phenyl-1,2-oxazol-5-yl)amino]methyl 4-carbonochloridoylbenzoate (CID 87620603) is [(3-phenyl-1,2-oxazol-5-yl)amino]methyl 4-carbonochloridoylbenzoate.
What is the SMILES notation for [(3-phenyl-1,2-oxazol-5-yl)amino]methyl 4-carbonochloridoylbenzoate?
The canonical SMILES for [(3-phenyl-1,2-oxazol-5-yl)amino]methyl 4-carbonochloridoylbenzoate is O=C(Cl)c1ccc(C(=O)OCNc2cc(-c3ccccc3)no2)cc1.
What is the InChIKey of [(3-phenyl-1,2-oxazol-5-yl)amino]methyl 4-carbonochloridoylbenzoate?
The InChIKey is QTSDFXGOSHBBMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13ClN2O4/c19-17(22)13-6-8-14(9-7-13)18(23)24-11-20-16-10-15(21-25-16)12-4-2-1-3-5-12/h1-10,20H,11H2.
What are the key properties of [(3-phenyl-1,2-oxazol-5-yl)amino]methyl 4-carbonochloridoylbenzoate?
[(3-phenyl-1,2-oxazol-5-yl)amino]methyl 4-carbonochloridoylbenzoate has a molecular weight of 356.77 g/mol, XLogP of 3.95, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3-phenyl-1,2-oxazol-5-yl)amino]methyl 4-carbonochloridoylbenzoate is sourced from PubChem (CID 87620603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).