C25H31ClF3NO2 — CID 87620686
1-hexyl-6,7-dimethoxy-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydroisoquinolin-2-ium chloride (PubChem CID 87620686) has the molecular formula C25H31ClF3NO2 and a molecular weight of 469.98 g/mol. Its IUPAC name is 1-hexyl-6,7-dimethoxy-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydroisoquinolin-2-ium chloride.
| Compound Name | 1-hexyl-6,7-dimethoxy-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydroisoquinolin-2-ium chloride |
|---|---|
| PubChem CID | 87620686 |
| Molecular Formula | C25H31ClF3NO2 |
| Molecular Weight | 469.98 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 1-hexyl-6,7-dimethoxy-2-[[4-(trifluoromethyl)phenyl]methyl]-3,4-dihydroisoquinolin-2-ium chloride |
| SMILES | CCCCCCC1=[N+](Cc2ccc(C(F)(F)F)cc2)CCc2cc(OC)c(OC)cc21.[Cl-] |
| InChI | InChI=1S/C25H31F3NO2.ClH/c1-4-5-6-7-8-22-21-16-24(31-3)23(30-2)15-19(21)13-14-29(22)17-18-9-11-20(12-10-18)25(26,27)28;/h9-12,15-16H,4-8,13-14,17H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | NEIXDWXQOVNAGY-UHFFFAOYSA-M |
| XLogP | 3.25 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.98 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|