C23H27F3N2O5 — CID 87621118
1-[3,3-dimethyl-4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]pyrrolidin-1-yl]-2,2,2-trifluoroethanone;oxalic acid (PubChem CID 87621118) has the molecular formula C23H27F3N2O5 and a molecular weight of 468.47 g/mol. Its IUPAC name is 1-[3,3-dimethyl-4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]pyrrolidin-1-yl]-2,2,2-trifluoroethanone;oxalic acid.
| Compound Name | 1-[3,3-dimethyl-4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]pyrrolidin-1-yl]-2,2,2-trifluoroethanone;oxalic acid |
|---|---|
| PubChem CID | 87621118 |
| Molecular Formula | C23H27F3N2O5 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 1-[3,3-dimethyl-4-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]pyrrolidin-1-yl]-2,2,2-trifluoroethanone;oxalic acid |
| SMILES | C[C@@H](NCC1CN(C(=O)C(F)(F)F)CC1(C)C)c1cccc2ccccc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H25F3N2O.C2H2O4/c1-14(17-10-6-8-15-7-4-5-9-18(15)17)25-11-16-12-26(13-20(16,2)3)19(27)21(22,23)24;3-1(4)2(5)6/h4-10,14,16,25H,11-13H2,1-3H3;(H,3,4)(H,5,6)/t14-,16?;/m1./s1 |
| InChIKey | IZKRVCYXYBYJNC-VHCCSVTPSA-N |
| XLogP | 3.69 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|