About 2-butylperoxyaniline
2-butylperoxyaniline (PubChem CID 87621409) has the molecular formula C10H15NO2
and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-butylperoxyaniline.
Molecular Properties
| Compound Name | 2-butylperoxyaniline |
| PubChem CID | 87621409 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 2-butylperoxyaniline |
| SMILES | CCCCOOc1ccccc1N |
| InChI | InChI=1S/C10H15NO2/c1-2-3-8-12-13-10-7-5-4-6-9(10)11/h4-7H,2-3,8,11H2,1H3 |
| InChIKey | PBRXVDAURVZICU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-butylperoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylperoxyaniline?
The IUPAC name of 2-butylperoxyaniline (CID 87621409) is 2-butylperoxyaniline.
What is the SMILES notation for 2-butylperoxyaniline?
The canonical SMILES for 2-butylperoxyaniline is CCCCOOc1ccccc1N.
What is the InChIKey of 2-butylperoxyaniline?
The InChIKey is PBRXVDAURVZICU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-2-3-8-12-13-10-7-5-4-6-9(10)11/h4-7H,2-3,8,11H2,1H3.
What are the key properties of 2-butylperoxyaniline?
2-butylperoxyaniline has a molecular weight of 181.24 g/mol, XLogP of 2.38, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylperoxyaniline is sourced from PubChem (CID 87621409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).