About 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-pentyl-3,4-dihydroisoquinolin-2-ium
2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-pentyl-3,4-dihydroisoquinolin-2-ium (PubChem CID 87621422) has the molecular formula C23H28ClFNO2+
and a molecular weight of 404.93 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-pentyl-3,4-dihydroisoquinolin-2-ium.
Molecular Properties
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-pentyl-3,4-dihydroisoquinolin-2-ium |
| PubChem CID | 87621422 |
| Molecular Formula | C23H28ClFNO2+ |
| Molecular Weight | 404.93 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-pentyl-3,4-dihydroisoquinolin-2-ium |
| SMILES | CCCCCC1=[N+](Cc2c(F)cccc2Cl)CCc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C23H28ClFNO2/c1-4-5-6-10-21-17-14-23(28-3)22(27-2)13-16(17)11-12-26(21)15-18-19(24)8-7-9-20(18)25/h7-9,13-14H,4-6,10-12,15H2,1-3H3/q+1 |
| InChIKey | BPVAOOJFXJJJOZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.93 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-pentyl-3,4-dihydroisoquinolin-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-pentyl-3,4-dihydroisoquinolin-2-ium?
The IUPAC name of 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-pentyl-3,4-dihydroisoquinolin-2-ium (CID 87621422) is 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-pentyl-3,4-dihydroisoquinolin-2-ium.
What is the SMILES notation for 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-pentyl-3,4-dihydroisoquinolin-2-ium?
The canonical SMILES for 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-pentyl-3,4-dihydroisoquinolin-2-ium is CCCCCC1=[N+](Cc2c(F)cccc2Cl)CCc2cc(OC)c(OC)cc21.
What is the InChIKey of 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-pentyl-3,4-dihydroisoquinolin-2-ium?
The InChIKey is BPVAOOJFXJJJOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28ClFNO2/c1-4-5-6-10-21-17-14-23(28-3)22(27-2)13-16(17)11-12-26(21)15-18-19(24)8-7-9-20(18)25/h7-9,13-14H,4-6,10-12,15H2,1-3H3/q+1.
What are the key properties of 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-pentyl-3,4-dihydroisoquinolin-2-ium?
2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-pentyl-3,4-dihydroisoquinolin-2-ium has a molecular weight of 404.93 g/mol, XLogP of 5.63, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-pentyl-3,4-dihydroisoquinolin-2-ium is sourced from PubChem (CID 87621422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).