About 1-(4-chlorophenyl)-2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium
1-(4-chlorophenyl)-2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium (PubChem CID 87621440) has the molecular formula C24H22ClFNO2+
and a molecular weight of 410.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium |
| PubChem CID | 87621440 |
| Molecular Formula | C24H22ClFNO2+ |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium |
| SMILES | COc1cc2c(cc1OC)C(c1ccc(Cl)cc1)=[N+](Cc1ccccc1F)CC2 |
| InChI | InChI=1S/C24H22ClFNO2/c1-28-22-13-17-11-12-27(15-18-5-3-4-6-21(18)26)24(20(17)14-23(22)29-2)16-7-9-19(25)10-8-16/h3-10,13-14H,11-12,15H2,1-2H3/q+1 |
| InChIKey | ZKSVVDSIHQNTCF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chlorophenyl)-2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium?
The IUPAC name of 1-(4-chlorophenyl)-2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium (CID 87621440) is 1-(4-chlorophenyl)-2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium.
What is the SMILES notation for 1-(4-chlorophenyl)-2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium?
The canonical SMILES for 1-(4-chlorophenyl)-2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium is COc1cc2c(cc1OC)C(c1ccc(Cl)cc1)=[N+](Cc1ccccc1F)CC2.
What is the InChIKey of 1-(4-chlorophenyl)-2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium?
The InChIKey is ZKSVVDSIHQNTCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22ClFNO2/c1-28-22-13-17-11-12-27(15-18-5-3-4-6-21(18)26)24(20(17)14-23(22)29-2)16-7-9-19(25)10-8-16/h3-10,13-14H,11-12,15H2,1-2H3/q+1.
What are the key properties of 1-(4-chlorophenyl)-2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium?
1-(4-chlorophenyl)-2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium has a molecular weight of 410.90 g/mol, XLogP of 5.10, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium is sourced from PubChem (CID 87621440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).