C27H27ClFNO2 — CID 87621460
5-(4-tert-butylphenyl)-6-[(2-fluorophenyl)methyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium chloride (PubChem CID 87621460) has the molecular formula C27H27ClFNO2 and a molecular weight of 451.97 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-6-[(2-fluorophenyl)methyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium chloride.
| Compound Name | 5-(4-tert-butylphenyl)-6-[(2-fluorophenyl)methyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium chloride |
|---|---|
| PubChem CID | 87621460 |
| Molecular Formula | C27H27ClFNO2 |
| Molecular Weight | 451.97 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 5-(4-tert-butylphenyl)-6-[(2-fluorophenyl)methyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium chloride |
| SMILES | CC(C)(C)c1ccc(C2=[N+](Cc3ccccc3F)CCc3cc4c(cc32)OCO4)cc1.[Cl-] |
| InChI | InChI=1S/C27H27FNO2.ClH/c1-27(2,3)21-10-8-18(9-11-21)26-22-15-25-24(30-17-31-25)14-19(22)12-13-29(26)16-20-6-4-5-7-23(20)28;/h4-11,14-15H,12-13,16-17H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | UWINIPFYUOLLQE-UHFFFAOYSA-M |
| XLogP | 2.46 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.97 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|