C11H20NO6P — CID 87621768
[(Z)-4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobut-2-enyl]-methylphosphinic acid (PubChem CID 87621768) has the molecular formula C11H20NO6P and a molecular weight of 293.26 g/mol. Its IUPAC name is [(Z)-4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobut-2-enyl]-methylphosphinic acid.
| Compound Name | [(Z)-4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobut-2-enyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 87621768 |
| Molecular Formula | C11H20NO6P |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | [(Z)-4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobut-2-enyl]-methylphosphinic acid |
| SMILES | COC(=O)/C(=C/CP(C)(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H20NO6P/c1-11(2,3)18-10(14)12-8(9(13)17-4)6-7-19(5,15)16/h6H,7H2,1-5H3,(H,12,14)(H,15,16)/b8-6- |
| InChIKey | YVOUBXSJZRUJSP-VURMDHGXSA-N |
| XLogP | 1.47 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|