C46H24F12N2O6 — CID 87621810
5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(3-phenoxyphenyl)propan-2-yl]phenoxy]phenyl]isoindole-1,3-dione (PubChem CID 87621810) has the molecular formula C46H24F12N2O6 and a molecular weight of 928.68 g/mol. Its IUPAC name is 5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(3-phenoxyphenyl)propan-2-yl]phenoxy]phenyl]isoindole-1,3-dione.
| Compound Name | 5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(3-phenoxyphenyl)propan-2-yl]phenoxy]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 87621810 |
| Molecular Formula | C46H24F12N2O6 |
| Molecular Weight | 928.68 g/mol |
| Exact Mass | 928.14 |
| IUPAC Name | 5-[2-(1,3-dioxoisoindol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(3-phenoxyphenyl)propan-2-yl]phenoxy]phenyl]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(C(c3ccc4c(c3)C(=O)N(c3ccc(Oc5ccc(C(c6cccc(Oc7ccccc7)c6)(C(F)(F)F)C(F)(F)F)cc5)cc3)C4=O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C46H24F12N2O6/c47-43(48,49)41(44(50,51)52,25-5-4-8-32(21-25)66-29-6-2-1-3-7-29)24-9-15-30(16-10-24)65-31-17-13-28(14-18-31)60-39(63)34-20-12-27(23-36(34)40(60)64)42(45(53,54)55,46(56,57)58)26-11-19-33-35(22-26)38(62)59-37(33)61/h1-23H,(H,59,61,62) |
| InChIKey | NUCXAGJONWJBHP-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.68 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|