About 6-chloro-4-(3,4-dimethylphenyl)pyrido[3,2-d]pyrimidin-2-amine
6-chloro-4-(3,4-dimethylphenyl)pyrido[3,2-d]pyrimidin-2-amine (PubChem CID 87622003) has the molecular formula C15H13ClN4
and a molecular weight of 284.75 g/mol. Its IUPAC name is 6-chloro-4-(3,4-dimethylphenyl)pyrido[3,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 6-chloro-4-(3,4-dimethylphenyl)pyrido[3,2-d]pyrimidin-2-amine |
| PubChem CID | 87622003 |
| Molecular Formula | C15H13ClN4 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 6-chloro-4-(3,4-dimethylphenyl)pyrido[3,2-d]pyrimidin-2-amine |
| SMILES | Cc1ccc(-c2nc(N)nc3ccc(Cl)nc23)cc1C |
| InChI | InChI=1S/C15H13ClN4/c1-8-3-4-10(7-9(8)2)13-14-11(18-15(17)20-13)5-6-12(16)19-14/h3-7H,1-2H3,(H2,17,18,20) |
| InChIKey | IZJAAMBCXLPTDC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-(3,4-dimethylphenyl)pyrido[3,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-(3,4-dimethylphenyl)pyrido[3,2-d]pyrimidin-2-amine?
The IUPAC name of 6-chloro-4-(3,4-dimethylphenyl)pyrido[3,2-d]pyrimidin-2-amine (CID 87622003) is 6-chloro-4-(3,4-dimethylphenyl)pyrido[3,2-d]pyrimidin-2-amine.
What is the SMILES notation for 6-chloro-4-(3,4-dimethylphenyl)pyrido[3,2-d]pyrimidin-2-amine?
The canonical SMILES for 6-chloro-4-(3,4-dimethylphenyl)pyrido[3,2-d]pyrimidin-2-amine is Cc1ccc(-c2nc(N)nc3ccc(Cl)nc23)cc1C.
What is the InChIKey of 6-chloro-4-(3,4-dimethylphenyl)pyrido[3,2-d]pyrimidin-2-amine?
The InChIKey is IZJAAMBCXLPTDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN4/c1-8-3-4-10(7-9(8)2)13-14-11(18-15(17)20-13)5-6-12(16)19-14/h3-7H,1-2H3,(H2,17,18,20).
What are the key properties of 6-chloro-4-(3,4-dimethylphenyl)pyrido[3,2-d]pyrimidin-2-amine?
6-chloro-4-(3,4-dimethylphenyl)pyrido[3,2-d]pyrimidin-2-amine has a molecular weight of 284.75 g/mol, XLogP of 3.54, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-(3,4-dimethylphenyl)pyrido[3,2-d]pyrimidin-2-amine is sourced from PubChem (CID 87622003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).