About ethyl 6-fluoro-2-methyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate
ethyl 6-fluoro-2-methyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate (PubChem CID 87622225) has the molecular formula C13H15FNO2+
and a molecular weight of 236.27 g/mol. Its IUPAC name is ethyl 6-fluoro-2-methyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-fluoro-2-methyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate |
| PubChem CID | 87622225 |
| Molecular Formula | C13H15FNO2+ |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | ethyl 6-fluoro-2-methyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate |
| SMILES | CCOC(=O)C1=[N+](C)CCc2cc(F)ccc21 |
| InChI | InChI=1S/C13H15FNO2/c1-3-17-13(16)12-11-5-4-10(14)8-9(11)6-7-15(12)2/h4-5,8H,3,6-7H2,1-2H3/q+1 |
| InChIKey | VEULXOSELNCROC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-fluoro-2-methyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-fluoro-2-methyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate?
The IUPAC name of ethyl 6-fluoro-2-methyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate (CID 87622225) is ethyl 6-fluoro-2-methyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate.
What is the SMILES notation for ethyl 6-fluoro-2-methyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate?
The canonical SMILES for ethyl 6-fluoro-2-methyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate is CCOC(=O)C1=[N+](C)CCc2cc(F)ccc21.
What is the InChIKey of ethyl 6-fluoro-2-methyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate?
The InChIKey is VEULXOSELNCROC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FNO2/c1-3-17-13(16)12-11-5-4-10(14)8-9(11)6-7-15(12)2/h4-5,8H,3,6-7H2,1-2H3/q+1.
What are the key properties of ethyl 6-fluoro-2-methyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate?
ethyl 6-fluoro-2-methyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate has a molecular weight of 236.27 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-fluoro-2-methyl-3,4-dihydroisoquinolin-2-ium-1-carboxylate is sourced from PubChem (CID 87622225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).