About 2-(2,4-dichlorophenyl)ethanethial
2-(2,4-dichlorophenyl)ethanethial (PubChem CID 87622266) has the molecular formula C8H6Cl2S
and a molecular weight of 205.11 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)ethanethial.
Molecular Properties
| Compound Name | 2-(2,4-dichlorophenyl)ethanethial |
| PubChem CID | 87622266 |
| Molecular Formula | C8H6Cl2S |
| Molecular Weight | 205.11 g/mol |
| Exact Mass | 203.96 |
| IUPAC Name | 2-(2,4-dichlorophenyl)ethanethial |
| SMILES | S=CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H6Cl2S/c9-7-2-1-6(3-4-11)8(10)5-7/h1-2,4-5H,3H2 |
| InChIKey | CDNRGGKKPFBPTE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.11 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dichlorophenyl)ethanethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dichlorophenyl)ethanethial?
The IUPAC name of 2-(2,4-dichlorophenyl)ethanethial (CID 87622266) is 2-(2,4-dichlorophenyl)ethanethial.
What is the SMILES notation for 2-(2,4-dichlorophenyl)ethanethial?
The canonical SMILES for 2-(2,4-dichlorophenyl)ethanethial is S=CCc1ccc(Cl)cc1Cl.
What is the InChIKey of 2-(2,4-dichlorophenyl)ethanethial?
The InChIKey is CDNRGGKKPFBPTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2S/c9-7-2-1-6(3-4-11)8(10)5-7/h1-2,4-5H,3H2.
What are the key properties of 2-(2,4-dichlorophenyl)ethanethial?
2-(2,4-dichlorophenyl)ethanethial has a molecular weight of 205.11 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dichlorophenyl)ethanethial is sourced from PubChem (CID 87622266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).