About dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane
dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane (PubChem CID 87622784) has the molecular formula C24H35BF3P
and a molecular weight of 422.32 g/mol. Its IUPAC name is dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane.
Molecular Properties
| Compound Name | dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane |
| PubChem CID | 87622784 |
| Molecular Formula | C24H35BF3P |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane |
| SMILES | CC1=C(C)C(C)c2cccc(P(C3CCCCC3)C3CCCCC3)c21.FB(F)F |
| InChI | InChI=1S/C24H35P.BF3/c1-17-18(2)22-15-10-16-23(24(22)19(17)3)25(20-11-6-4-7-12-20)21-13-8-5-9-14-21;2-1(3)4/h10,15-16,18,20-21H,4-9,11-14H2,1-3H3; |
| InChIKey | MBOOEQVKVAOSGA-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane?
The IUPAC name of dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane (CID 87622784) is dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane.
What is the SMILES notation for dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane?
The canonical SMILES for dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane is CC1=C(C)C(C)c2cccc(P(C3CCCCC3)C3CCCCC3)c21.FB(F)F.
What is the InChIKey of dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane?
The InChIKey is MBOOEQVKVAOSGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H35P.BF3/c1-17-18(2)22-15-10-16-23(24(22)19(17)3)25(20-11-6-4-7-12-20)21-13-8-5-9-14-21;2-1(3)4/h10,15-16,18,20-21H,4-9,11-14H2,1-3H3;.
What are the key properties of dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane?
dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane has a molecular weight of 422.32 g/mol, XLogP of 8.25, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane is sourced from PubChem (CID 87622784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).