C24H35BF3P — CID 87622784
dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane (PubChem CID 87622784) has the molecular formula C24H35BF3P and a molecular weight of 422.32 g/mol. Its IUPAC name is dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane.
| Compound Name | dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane |
|---|---|
| PubChem CID | 87622784 |
| Molecular Formula | C24H35BF3P |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | dicyclohexyl-(1,2,3-trimethyl-1H-inden-4-yl)phosphane;trifluoroborane |
| SMILES | CC1=C(C)C(C)c2cccc(P(C3CCCCC3)C3CCCCC3)c21.FB(F)F |
| InChI | InChI=1S/C24H35P.BF3/c1-17-18(2)22-15-10-16-23(24(22)19(17)3)25(20-11-6-4-7-12-20)21-13-8-5-9-14-21;2-1(3)4/h10,15-16,18,20-21H,4-9,11-14H2,1-3H3; |
| InChIKey | MBOOEQVKVAOSGA-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|