About 2-amino-N-(2,2-difluoroethyl)-3,3-dimethylbutanamide
2-amino-N-(2,2-difluoroethyl)-3,3-dimethylbutanamide (PubChem CID 87622940) has the molecular formula C8H16F2N2O
and a molecular weight of 194.22 g/mol. Its IUPAC name is 2-amino-N-(2,2-difluoroethyl)-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | 2-amino-N-(2,2-difluoroethyl)-3,3-dimethylbutanamide |
| PubChem CID | 87622940 |
| Molecular Formula | C8H16F2N2O |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-amino-N-(2,2-difluoroethyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)C(N)C(=O)NCC(F)F |
| InChI | InChI=1S/C8H16F2N2O/c1-8(2,3)6(11)7(13)12-4-5(9)10/h5-6H,4,11H2,1-3H3,(H,12,13) |
| InChIKey | MMGVYFGFAIFCEQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-N-(2,2-difluoroethyl)-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(2,2-difluoroethyl)-3,3-dimethylbutanamide?
The IUPAC name of 2-amino-N-(2,2-difluoroethyl)-3,3-dimethylbutanamide (CID 87622940) is 2-amino-N-(2,2-difluoroethyl)-3,3-dimethylbutanamide.
What is the SMILES notation for 2-amino-N-(2,2-difluoroethyl)-3,3-dimethylbutanamide?
The canonical SMILES for 2-amino-N-(2,2-difluoroethyl)-3,3-dimethylbutanamide is CC(C)(C)C(N)C(=O)NCC(F)F.
What is the InChIKey of 2-amino-N-(2,2-difluoroethyl)-3,3-dimethylbutanamide?
The InChIKey is MMGVYFGFAIFCEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2N2O/c1-8(2,3)6(11)7(13)12-4-5(9)10/h5-6H,4,11H2,1-3H3,(H,12,13).
What are the key properties of 2-amino-N-(2,2-difluoroethyl)-3,3-dimethylbutanamide?
2-amino-N-(2,2-difluoroethyl)-3,3-dimethylbutanamide has a molecular weight of 194.22 g/mol, XLogP of 0.74, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(2,2-difluoroethyl)-3,3-dimethylbutanamide is sourced from PubChem (CID 87622940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).