C10H13F6O3P — CID 87623348
3-[ethyl(1,1,1-trifluorobut-3-en-2-yloxy)phosphoryl]oxy-4,4,4-trifluorobut-1-ene (PubChem CID 87623348) has the molecular formula C10H13F6O3P and a molecular weight of 326.17 g/mol. Its IUPAC name is 3-[ethyl(1,1,1-trifluorobut-3-en-2-yloxy)phosphoryl]oxy-4,4,4-trifluorobut-1-ene.
| Compound Name | 3-[ethyl(1,1,1-trifluorobut-3-en-2-yloxy)phosphoryl]oxy-4,4,4-trifluorobut-1-ene |
|---|---|
| PubChem CID | 87623348 |
| Molecular Formula | C10H13F6O3P |
| Molecular Weight | 326.17 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 3-[ethyl(1,1,1-trifluorobut-3-en-2-yloxy)phosphoryl]oxy-4,4,4-trifluorobut-1-ene |
| SMILES | C=CC(OP(=O)(CC)OC(C=C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H13F6O3P/c1-4-7(9(11,12)13)18-20(17,6-3)19-8(5-2)10(14,15)16/h4-5,7-8H,1-2,6H2,3H3 |
| InChIKey | UELZPLOEYLMMRJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.17 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|