C26H39BF3O2P — CID 87623433
dicyclohexyl-(4,7-dimethoxy-1,2,3-trimethyl-1H-inden-5-yl)phosphane;trifluoroborane (PubChem CID 87623433) has the molecular formula C26H39BF3O2P and a molecular weight of 482.38 g/mol. Its IUPAC name is dicyclohexyl-(4,7-dimethoxy-1,2,3-trimethyl-1H-inden-5-yl)phosphane;trifluoroborane.
| Compound Name | dicyclohexyl-(4,7-dimethoxy-1,2,3-trimethyl-1H-inden-5-yl)phosphane;trifluoroborane |
|---|---|
| PubChem CID | 87623433 |
| Molecular Formula | C26H39BF3O2P |
| Molecular Weight | 482.38 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | dicyclohexyl-(4,7-dimethoxy-1,2,3-trimethyl-1H-inden-5-yl)phosphane;trifluoroborane |
| SMILES | COc1cc(P(C2CCCCC2)C2CCCCC2)c(OC)c2c1C(C)C(C)=C2C.FB(F)F |
| InChI | InChI=1S/C26H39O2P.BF3/c1-17-18(2)24-22(27-4)16-23(26(28-5)25(24)19(17)3)29(20-12-8-6-9-13-20)21-14-10-7-11-15-21;2-1(3)4/h16,18,20-21H,6-15H2,1-5H3; |
| InChIKey | OIYDILKCBDBBJX-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.38 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|