C22H30F2N2O8S2 — CID 87623450
1-[3-[(3,5-difluorophenyl)methoxy]-3,4-dihydro-2H-chromen-4-yl]piperazine;methanesulfonic acid (PubChem CID 87623450) has the molecular formula C22H30F2N2O8S2 and a molecular weight of 552.62 g/mol. Its IUPAC name is 1-[3-[(3,5-difluorophenyl)methoxy]-3,4-dihydro-2H-chromen-4-yl]piperazine;methanesulfonic acid.
| Compound Name | 1-[3-[(3,5-difluorophenyl)methoxy]-3,4-dihydro-2H-chromen-4-yl]piperazine;methanesulfonic acid |
|---|---|
| PubChem CID | 87623450 |
| Molecular Formula | C22H30F2N2O8S2 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | 1-[3-[(3,5-difluorophenyl)methoxy]-3,4-dihydro-2H-chromen-4-yl]piperazine;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.Fc1cc(F)cc(COC2COc3ccccc3C2N2CCNCC2)c1 |
| InChI | InChI=1S/C20H22F2N2O2.2CH4O3S/c21-15-9-14(10-16(22)11-15)12-25-19-13-26-18-4-2-1-3-17(18)20(19)24-7-5-23-6-8-24;2*1-5(2,3)4/h1-4,9-11,19-20,23H,5-8,12-13H2;2*1H3,(H,2,3,4) |
| InChIKey | VIMOWUMPQASAEW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|