C10H10F12O2S — CID 87623489
1,1,1,5,5,5-hexafluoro-3-(1,1,1,5,5,5-hexafluoropentan-3-ylsulfonyl)pentane (PubChem CID 87623489) has the molecular formula C10H10F12O2S and a molecular weight of 422.23 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-3-(1,1,1,5,5,5-hexafluoropentan-3-ylsulfonyl)pentane.
| Compound Name | 1,1,1,5,5,5-hexafluoro-3-(1,1,1,5,5,5-hexafluoropentan-3-ylsulfonyl)pentane |
|---|---|
| PubChem CID | 87623489 |
| Molecular Formula | C10H10F12O2S |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-3-(1,1,1,5,5,5-hexafluoropentan-3-ylsulfonyl)pentane |
| SMILES | O=S(=O)(C(CC(F)(F)F)CC(F)(F)F)C(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C10H10F12O2S/c11-7(12,13)1-5(2-8(14,15)16)25(23,24)6(3-9(17,18)19)4-10(20,21)22/h5-6H,1-4H2 |
| InChIKey | OQPYSIRXBYMLFH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |